Difference between revisions of "CPD-381"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
(Created page with "Category:metabolite == Metabolite CPD-8088 == * common-name: ** 1-linoleoyl-2-oleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2121 ==
+
== Metabolite CPD-8088 ==
 
* common-name:
 
* common-name:
** trans-hex-2-enoyl-coa
+
** 1-linoleoyl-2-oleoyl-phosphatidylcholine
 
* smiles:
 
* smiles:
** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
* inchi-key:
** oinxhibnzuuimr-ixuyqxaasa-j
+
** rtazwrzkfstmoy-nmsvecgzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 859.631
+
** 784.107
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH2h]]
+
* [[RXN-8321]]
* [[RXN-12559]]
+
* [[RXN-8328]]
* [[RXN-14278]]
 
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECOAH2h]]
+
* [[RXN-8320]]
* [[RXN-12567]]
 
* [[RXN-14278]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-hex-2-enoyl-coa}}
+
{{#set: common-name=1-linoleoyl-2-oleoyl-phosphatidylcholine}}
{{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}}
+
{{#set: inchi-key=inchikey=rtazwrzkfstmoy-nmsvecgzsa-n}}
{{#set: molecular-weight=859.631}}
+
{{#set: molecular-weight=784.107}}

Revision as of 14:56, 5 January 2021

Metabolite CPD-8088

  • common-name:
    • 1-linoleoyl-2-oleoyl-phosphatidylcholine
  • smiles:
    • cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • rtazwrzkfstmoy-nmsvecgzsa-n
  • molecular-weight:
    • 784.107

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality