Difference between revisions of "CPD-381"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-P-HYDROXYPYRUVATE == * common-name: ** 3-phosphooxypyruvate * smiles: ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] * inchi-key: ** lflucdosqpjj...") |
(Created page with "Category:metabolite == Metabolite ACETYL-ACP == * common-name: ** an acetyl-[acp] == Reaction(s) known to consume the compound == * 3-OXOACYL-ACP-SYNTH-BASE-RXN * AC...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ACETYL-ACP == |
* common-name: | * common-name: | ||
| − | ** | + | ** an acetyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3-OXOACYL-ACP-SYNTH-BASE-RXN]] |
| − | * [[ | + | * [[ACP-S-ACETYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACP-S-ACETYLTRANSFER-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an acetyl-[acp]}} |
| − | |||
| − | |||
Revision as of 13:09, 14 January 2021
Contents
Metabolite ACETYL-ACP
- common-name:
- an acetyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an acetyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
