Difference between revisions of "CPD-381"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-ACP == * common-name: ** an acetyl-[acp] == Reaction(s) known to consume the compound == * 3-OXOACYL-ACP-SYNTH-BASE-RXN * AC...")
(Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETYL-ACP ==
+
== Metabolite GALACTOSE-1P ==
 
* common-name:
 
* common-name:
** an acetyl-[acp]
+
** α-d-galactose 1-phosphate
 +
* smiles:
 +
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 +
* inchi-key:
 +
** hxxfsfrbohsimq-fprjbgldsa-l
 +
* molecular-weight:
 +
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
+
* [[GALACTOKIN-RXN]]
* [[ACP-S-ACETYLTRANSFER-RXN]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACP-S-ACETYLTRANSFER-RXN]]
+
* [[GALACTOKIN-RXN]]
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an acetyl-[acp]}}
+
{{#set: common-name=α-d-galactose 1-phosphate}}
 +
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-fprjbgldsa-l}}
 +
{{#set: molecular-weight=258.121}}

Revision as of 18:55, 14 January 2021

Metabolite GALACTOSE-1P

  • common-name:
    • α-d-galactose 1-phosphate
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • hxxfsfrbohsimq-fprjbgldsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality