Difference between revisions of "CPD-7285"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Relaxed-DNAs == * common-name: ** a relaxed dna == Reaction(s) known to consume the compound == * 5.99.1.2-RXN == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NOREPINEPHRINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-noradrenaline |
| + | * smiles: | ||
| + | ** c1(c=c(o)c(=cc=1c(c[n+])o)o) | ||
| + | * inchi-key: | ||
| + | ** sflshlfxelfnjz-qmmmgpobsa-o | ||
| + | * molecular-weight: | ||
| + | ** 170.188 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10907]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-noradrenaline}} |
| + | {{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}} | ||
| + | {{#set: molecular-weight=170.188}} | ||
Revision as of 18:57, 14 January 2021
Contents
Metabolite NOREPINEPHRINE
- common-name:
- (r)-noradrenaline
- smiles:
- c1(c=c(o)c(=cc=1c(c[n+])o)o)
- inchi-key:
- sflshlfxelfnjz-qmmmgpobsa-o
- molecular-weight:
- 170.188
