Difference between revisions of "CPD-8080"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-SELENOCYSTEINE == * common-name: ** l-selenocysteine * smiles: ** c([se])c([n+])c([o-])=o * inchi-key: ** zkzbpngneqajsx-reohclbhsa-n *...")
(Created page with "Category:metabolite == Metabolite CPD-8080 == * common-name: ** 1-18:2-2-16:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-SELENOCYSTEINE ==
+
== Metabolite CPD-8080 ==
 
* common-name:
 
* common-name:
** l-selenocysteine
+
** 1-18:2-2-16:3-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** c([se])c([n+])c([o-])=o
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** zkzbpngneqajsx-reohclbhsa-n
+
** dvrkgrmgqjlnpc-nidyupdjsa-n
 
* molecular-weight:
 
* molecular-weight:
** 168.054
+
** 749.036
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACHMSSELCYSL]]
+
* [[RXN-8301]]
* [[ACHMSSELCYSLh]]
 
* [[RXN-12728]]
 
* [[SELENOCYSTEINE-LYASE-RXN]]
 
* [[SUCHMSSELCYSL]]
 
* [[SUCHMSSELCYSLh]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12726]]
+
* [[RXN-8306]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-selenocysteine}}
+
{{#set: common-name=1-18:2-2-16:3-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=zkzbpngneqajsx-reohclbhsa-n}}
+
{{#set: inchi-key=inchikey=dvrkgrmgqjlnpc-nidyupdjsa-n}}
{{#set: molecular-weight=168.054}}
+
{{#set: molecular-weight=749.036}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8080

  • common-name:
    • 1-18:2-2-16:3-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
  • inchi-key:
    • dvrkgrmgqjlnpc-nidyupdjsa-n
  • molecular-weight:
    • 749.036

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality