Difference between revisions of "CPD-8080"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07922 == * transcription-direction: ** negative * right-end-position: ** 12596 * left-end-position: ** 6043 * centisome-position: ** 10.119566...")
(Created page with "Category:metabolite == Metabolite CPD-8080 == * common-name: ** 1-18:2-2-16:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ07922 ==
+
== Metabolite CPD-8080 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 1-18:2-2-16:3-monogalactosyldiacylglycerol
−
* right-end-position:
+
* smiles:
−
** 12596
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
−
* left-end-position:
+
* inchi-key:
−
** 6043
+
** dvrkgrmgqjlnpc-nidyupdjsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 10.119566   
+
** 749.036
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8301]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[FADSYN-RXN]]
+
* [[RXN-8306]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=1-18:2-2-16:3-monogalactosyldiacylglycerol}}
−
* [[RIBOFLAVINKIN-RXN]]
+
{{#set: inchi-key=inchikey=dvrkgrmgqjlnpc-nidyupdjsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=749.036}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN0-5187]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY66-366]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[RIBOSYN2-PWY]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6167]]
 
−
** '''5''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6168]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7863]]
 
−
** '''1''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-5523]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=12596}}
 
−
{{#set: left-end-position=6043}}
 
−
{{#set: centisome-position=10.119566    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8080

  • common-name:
    • 1-18:2-2-16:3-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
  • inchi-key:
    • dvrkgrmgqjlnpc-nidyupdjsa-n
  • molecular-weight:
    • 749.036

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8080&oldid=137884"