Difference between revisions of "CPD-8080"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite General-Protein-Substrates == * common-name: ** a protein == Reaction(s) known to consume the compound == <div class="toccolours mw-colla...") |
(Created page with "Category:metabolite == Metabolite CPD-8080 == * common-name: ** 1-18:2-2-16:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8080 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:2-2-16:3-monogalactosyldiacylglycerol |
| + | * smiles: | ||
| + | ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o | ||
| + | * inchi-key: | ||
| + | ** dvrkgrmgqjlnpc-nidyupdjsa-n | ||
| + | * molecular-weight: | ||
| + | ** 749.036 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-8301]] | |
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8306]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:2-2-16:3-monogalactosyldiacylglycerol}} |
| + | {{#set: inchi-key=inchikey=dvrkgrmgqjlnpc-nidyupdjsa-n}} | ||
| + | {{#set: molecular-weight=749.036}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-8080
- common-name:
- 1-18:2-2-16:3-monogalactosyldiacylglycerol
- smiles:
- cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
- inchi-key:
- dvrkgrmgqjlnpc-nidyupdjsa-n
- molecular-weight:
- 749.036
