Difference between revisions of "CPD-8166"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-Cysteine-Desulfurase-persulfide == * common-name: ** an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite CPD-8166 == * common-name: ** 1-18:2-2-18:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8166 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:2-2-18:3-monogalactosyldiacylglycerol |
| + | * smiles: | ||
| + | ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o | ||
| + | * inchi-key: | ||
| + | ** drlqfbrxasrgdp-bubqrnscsa-n | ||
| + | * molecular-weight: | ||
| + | ** 777.089 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8368]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8367]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:2-2-18:3-monogalactosyldiacylglycerol}} |
| + | {{#set: inchi-key=inchikey=drlqfbrxasrgdp-bubqrnscsa-n}} | ||
| + | {{#set: molecular-weight=777.089}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-8166
- common-name:
- 1-18:2-2-18:3-monogalactosyldiacylglycerol
- smiles:
- cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
- inchi-key:
- drlqfbrxasrgdp-bubqrnscsa-n
- molecular-weight:
- 777.089
