Difference between revisions of "CPD-8168"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Odd-Saturated-Fatty-Acyl-CoA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to c...") |
(Created page with "Category:metabolite == Metabolite CPD-8168 == * common-name: ** 1-18:3-2-18:3-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1)...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8168 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:3-2-18:3-monogalactosyldiacylglycerol |
| + | * smiles: | ||
| + | ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o | ||
| + | * inchi-key: | ||
| + | ** quzhzfaqjatmca-qazqwddosa-n | ||
| + | * molecular-weight: | ||
| + | ** 775.074 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8368]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:3-2-18:3-monogalactosyldiacylglycerol}} |
| + | {{#set: inchi-key=inchikey=quzhzfaqjatmca-qazqwddosa-n}} | ||
| + | {{#set: molecular-weight=775.074}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-8168
- common-name:
- 1-18:3-2-18:3-monogalactosyldiacylglycerol
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
- inchi-key:
- quzhzfaqjatmca-qazqwddosa-n
- molecular-weight:
- 775.074
