Difference between revisions of "CPD-8168"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** fpipgxgpppqfeq-ovs...")
(Created page with "Category:metabolite == Metabolite Odd-Saturated-Fatty-Acyl-CoA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13524 ==
+
== Metabolite Odd-Saturated-Fatty-Acyl-CoA ==
 
* common-name:
 
* common-name:
** all-trans-retinol
+
** an odd numbered straight chain 2,3,4-saturated fatty acyl coa
* smiles:
 
** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
 
* inchi-key:
 
** fpipgxgpppqfeq-ovsjkpmpsa-n
 
* molecular-weight:
 
** 286.456
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.99.23-RXN]]
 
* [[RETINOL-DEHYDROGENASE-RXN]]
 
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 
* [[RXN-10841]]
 
* [[RXN-12547]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.1.64-RXN]]
+
* [[RXN66-477]]
* [[RETINOL-DEHYDROGENASE-RXN]]
 
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 
* [[RXN-10841]]
 
* [[RXN-12575]]
 
* [[RXN-12579]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-retinol}}
+
{{#set: common-name=an odd numbered straight chain 2,3,4-saturated fatty acyl coa}}
{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
 
{{#set: molecular-weight=286.456}}
 

Revision as of 18:54, 14 January 2021

Metabolite Odd-Saturated-Fatty-Acyl-CoA

  • common-name:
    • an odd numbered straight chain 2,3,4-saturated fatty acyl coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality