Difference between revisions of "CPD-8168"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * smiles: ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** fpipgxgpppqfeq-ovs...") |
(Created page with "Category:metabolite == Metabolite Odd-Saturated-Fatty-Acyl-CoA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Odd-Saturated-Fatty-Acyl-CoA == |
* common-name: | * common-name: | ||
− | ** | + | ** an odd numbered straight chain 2,3,4-saturated fatty acyl coa |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-477]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an odd numbered straight chain 2,3,4-saturated fatty acyl coa}} |
− | |||
− |
Revision as of 18:54, 14 January 2021
Contents
Metabolite Odd-Saturated-Fatty-Acyl-CoA
- common-name:
- an odd numbered straight chain 2,3,4-saturated fatty acyl coa