Difference between revisions of "CPD-941"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14775 RXN-14775] == * direction: ** left-to-right * common-name: ** fatty acyl-coa oxidase ** a...") |
(Created page with "Category:metabolite == Metabolite CPD-941 == * common-name: ** s-(2-methylbutanoyl)-dihydrolipoamide * smiles: ** ccc(c(sccc(ccccc(n)=o)s)=o)c * inchi-key: ** ufncwfssegpj...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-941 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** s-(2-methylbutanoyl)-dihydrolipoamide |
| − | + | * smiles: | |
| − | * | + | ** ccc(c(sccc(ccccc(n)=o)s)=o)c |
| − | ** | + | * inchi-key: |
| − | + | ** ufncwfssegpjnl-uhfffaoysa-n | |
| − | + | * molecular-weight: | |
| − | + | ** 291.466 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[DHRT_LPAREN_2mbcoa_RPAREN_]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=s-(2-methylbutanoyl)-dihydrolipoamide}} | |
| − | + | {{#set: inchi-key=inchikey=ufncwfssegpjnl-uhfffaoysa-n}} | |
| − | + | {{#set: molecular-weight=291.466}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | ** | ||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-941
- common-name:
- s-(2-methylbutanoyl)-dihydrolipoamide
- smiles:
- ccc(c(sccc(ccccc(n)=o)s)=o)c
- inchi-key:
- ufncwfssegpjnl-uhfffaoysa-n
- molecular-weight:
- 291.466
