Difference between revisions of "CPD0-1905"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4193 RXNQT-4193] == * direction: ** left-to-right * common-name: ** long-chain-alcohol o-fatt...")
 
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4193 RXNQT-4193] ==
+
== Metabolite CPD0-1905 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** long-chain-alcohol o-fatty-acyltransferase
+
** 8-oxo-dgtp
−
** wax ester synthase
+
* smiles:
−
* ec-number:
+
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
−
** [http://enzyme.expasy.org/EC/2.3.1.75 ec-2.3.1.75]
+
* inchi-key:
−
== Reaction formula ==
+
** buzogvvqwcxxdp-vpeninkcsa-j
−
* 1 [[Long-Chain-Acyl-CoAs]][c] '''+''' 1 [[Very-Long-Chain-Alcohols]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[VLC-alcohol-LC-acyl-ester]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 519.151
−
* Gene: [[SJ01916]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-11396]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14205]]
−
* Gene: [[SJ02128]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-14205]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ18627]]
+
{{#set: common-name=8-oxo-dgtp}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=519.151}}
−
* Gene: [[SJ21726]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-282]], cuticular wax biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-282 PWY-282]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=38444 38444]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=long-chain-alcohol o-fatty-acyltransferase|wax ester synthase}}
 
−
{{#set: ec-number=ec-2.3.1.75}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD0-1905

  • common-name:
    • 8-oxo-dgtp
  • smiles:
    • c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • buzogvvqwcxxdp-vpeninkcsa-j
  • molecular-weight:
    • 519.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD0-1905&oldid=139714"