Difference between revisions of "CPD0-2231"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...") |
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c * inchi-key: ** gvvpgtzrzfn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GERANYL-PP == |
* common-name: | * common-name: | ||
| − | ** | + | ** geranyl diphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gvvpgtzrzfnkds-jxmrogbwsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 311.188 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[FPPS]] |
| − | * [[ | + | * [[FPPSYN-RXN]] |
| + | * [[GPPSYN-RXN]] | ||
| + | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GPPS]] |
| + | * [[GPPSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=geranyl diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=311.188}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite GERANYL-PP
- common-name:
- geranyl diphosphate
- smiles:
- cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
- inchi-key:
- gvvpgtzrzfnkds-jxmrogbwsa-k
- molecular-weight:
- 311.188
