Difference between revisions of "CPD0-2231"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ETHYLENE-CMPD == * common-name: ** ethene * smiles: ** c=c * inchi-key: ** vggsqfucumxweo-uhfffaoysa-n * molecular-weight: ** 28.054 == R...") |
(Created page with "Category:metabolite == Metabolite CPD0-2231 == * common-name: ** didp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** bk...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2231 == |
* common-name: | * common-name: | ||
| − | ** | + | ** didp |
* smiles: | * smiles: | ||
| − | ** c=c | + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bkusikgspsfqac-rrkcrqdmsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 409.165 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14228]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14228]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=didp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bkusikgspsfqac-rrkcrqdmsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=409.165}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD0-2231
- common-name:
- didp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- bkusikgspsfqac-rrkcrqdmsa-k
- molecular-weight:
- 409.165
