Difference between revisions of "DI-H-OROTATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLUCOSAMINYL-ETCETERA-MANNOSYL-R == * common-name: ** (n-acetyl-β-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-gluc...") |
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DI-H-OROTATE == |
* common-name: | * common-name: | ||
− | ** ( | + | ** (s)-dihydroorotate |
+ | * smiles: | ||
+ | ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) | ||
+ | * inchi-key: | ||
+ | ** ufivepvsagbusi-reohclbhsa-m | ||
+ | * molecular-weight: | ||
+ | ** 157.105 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[DIHYDROOROT-RXN]] |
+ | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] | ||
+ | * [[RXN0-6491]] | ||
+ | * [[RXN0-6554]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[DIHYDROOROT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=(s)-dihydroorotate}} |
+ | {{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}} | ||
+ | {{#set: molecular-weight=157.105}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DI-H-OROTATE
- common-name:
- (s)-dihydroorotate
- smiles:
- c1(c(=o)nc(=o)nc(c(=o)[o-])1)
- inchi-key:
- ufivepvsagbusi-reohclbhsa-m
- molecular-weight:
- 157.105