Difference between revisions of "DITP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9612 == * common-name: ** caldariellaquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2)...")
(Created page with "Category:metabolite == Metabolite CPD-3188 == * common-name: ** n'-hydroxymethyl-norcotinine * smiles: ** c1(=o)(cc[ch](n(co)1)c2(c=nc=cc=2)) * inchi-key: ** gqufobhepvfqm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9612 ==
+
== Metabolite CPD-3188 ==
 
* common-name:
 
* common-name:
** caldariellaquinone
+
** n'-hydroxymethyl-norcotinine
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
+
** c1(=o)(cc[ch](n(co)1)c2(c=nc=cc=2))
 
* inchi-key:
 
* inchi-key:
** ghrwxpxobgrshg-uhfffaoysa-n
+
** gqufobhepvfqmd-vifpvbqesa-n
 
* molecular-weight:
 
* molecular-weight:
** 631.069
+
** 192.217
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15378]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-169]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=caldariellaquinone}}
+
{{#set: common-name=n'-hydroxymethyl-norcotinine}}
{{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=gqufobhepvfqmd-vifpvbqesa-n}}
{{#set: molecular-weight=631.069}}
+
{{#set: molecular-weight=192.217}}

Revision as of 15:29, 5 January 2021

Metabolite CPD-3188

  • common-name:
    • n'-hydroxymethyl-norcotinine
  • smiles:
    • c1(=o)(cc[ch](n(co)1)c2(c=nc=cc=2))
  • inchi-key:
    • gqufobhepvfqmd-vifpvbqesa-n
  • molecular-weight:
    • 192.217

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality