Difference between revisions of "ETR-Quinols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...")
(Created page with "Category:metabolite == Metabolite ETR-Quinols == * common-name: ** an electron-transfer quinol == Reaction(s) known to consume the compound == * RXN-15816 == Reaction(...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHYTYL-PYROPHOSPHATE ==
+
== Metabolite ETR-Quinols ==
 
* common-name:
 
* common-name:
** phytyl diphosphate
+
** an electron-transfer quinol
* smiles:
 
** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 
* inchi-key:
 
** itplbnccpzsweu-pyddkjgssa-k
 
* molecular-weight:
 
** 453.471
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2541]]
+
* [[RXN-15816]]
* [[RXN-7660]]
 
* [[RXN-7674]]
 
* [[RXN1F-66]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10625]]
+
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
* [[RXN-7660]]
+
* [[NQOR-RXN]]
* [[RXN1F-66]]
+
* [[RXN-11356]]
 +
* [[RXN-11357]]
 +
* [[RXN-12242]]
 +
* [[RXN-14903]]
 +
* [[RXN-14971]]
 +
* [[RXN-15745]]
 +
* [[RXN0-7229]]
 +
* [[RXN0-7230]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phytyl diphosphate}}
+
{{#set: common-name=an electron-transfer quinol}}
{{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}}
 
{{#set: molecular-weight=453.471}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite ETR-Quinols

  • common-name:
    • an electron-transfer quinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality