Difference between revisions of "FARNESYL-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Nucleoside-Diphosphates == * common-name: ** a nucleoside diphosphate == Reaction(s) known to consume the compound == * 2.7.4.10-RXN...") |
(Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * smiles: ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c * inchi-k...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite FARNESYL-PP == |
* common-name: | * common-name: | ||
− | ** | + | ** (2e,6e)-farnesyl diphosphate |
+ | * smiles: | ||
+ | ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c | ||
+ | * inchi-key: | ||
+ | ** vwfjdquyciwhtn-yfvjmotdsa-k | ||
+ | * molecular-weight: | ||
+ | ** 379.306 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[2. | + | * [[2.5.1.58-RXN]] |
− | * [[ | + | * [[FARNESYLTRANSTRANSFERASE-RXN]] |
− | * [[ | + | * [[GGPS]] |
− | * [[ | + | * [[HEMEOSYN-RXN]] |
+ | * [[RXN-11963]] | ||
+ | * [[RXN-12263]] | ||
+ | * [[RXN-13162]] | ||
+ | * [[RXN-17573]] | ||
+ | * [[RXN-8999]] | ||
+ | * [[RXN-9969]] | ||
+ | * [[RXN0-5180]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[2. | + | * [[2.5.1.58-RXN]] |
− | * [[ | + | * [[FPPS]] |
− | * [[ | + | * [[FPPSYN-RXN]] |
+ | * [[RXN-11963]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2e,6e)-farnesyl diphosphate}} |
+ | {{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}} | ||
+ | {{#set: molecular-weight=379.306}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite FARNESYL-PP
- common-name:
- (2e,6e)-farnesyl diphosphate
- smiles:
- cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
- inchi-key:
- vwfjdquyciwhtn-yfvjmotdsa-k
- molecular-weight:
- 379.306
Reaction(s) known to consume the compound
- 2.5.1.58-RXN
- FARNESYLTRANSTRANSFERASE-RXN
- GGPS
- HEMEOSYN-RXN
- RXN-11963
- RXN-12263
- RXN-13162
- RXN-17573
- RXN-8999
- RXN-9969
- RXN0-5180