Difference between revisions of "FARNESYL-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17888 RXN-17888] == * direction: ** left-to-right * common-name: ** arginyl-trna--protein trans...")
(Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * smiles: ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c * inchi-k...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17888 RXN-17888] ==
+
== Metabolite FARNESYL-PP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** arginyl-trna--protein transferase
+
** (2e,6e)-farnesyl diphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.2.8 ec-2.3.2.8]
+
** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Charged-ARG-tRNAs]][c] '''+''' 1 [[L-Glutamyl-Peptides]][c] '''=>''' 1 [[ARG-tRNAs]][c] '''+''' 1 [[L-arginyl-L-Glutamyl-Peptides]][c] '''+''' 1 [[PROTON]][c]
+
** vwfjdquyciwhtn-yfvjmotdsa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03517]]
+
** 379.306
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.5.1.58-RXN]]
−
== Pathway(s) ==
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
−
* [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799]
+
* [[GGPS]]
−
** '''7''' reactions found over '''14''' reactions in the full pathway
+
* [[HEMEOSYN-RXN]]
−
== Reconstruction information  ==
+
* [[RXN-11963]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-12263]]
−
== External links  ==
+
* [[RXN-13162]]
−
{{#set: direction=left-to-right}}
+
* [[RXN-17573]]
−
{{#set: common-name=arginyl-trna--protein transferase}}
+
* [[RXN-8999]]
−
{{#set: ec-number=ec-2.3.2.8}}
+
* [[RXN-9969]]
−
{{#set: nb gene associated=1}}
+
* [[RXN0-5180]]
−
{{#set: nb pathway associated=1}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: reconstruction category=annotation}}
+
* [[2.5.1.58-RXN]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[FPPS]]
−
{{#set: reconstruction comment=n.a}}
+
* [[FPPSYN-RXN]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[RXN-11963]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
 +
{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}
 +
{{#set: molecular-weight=379.306}}

Latest revision as of 11:15, 18 March 2021

Metabolite FARNESYL-PP

  • common-name:
    • (2e,6e)-farnesyl diphosphate
  • smiles:
    • cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
  • inchi-key:
    • vwfjdquyciwhtn-yfvjmotdsa-k
  • molecular-weight:
    • 379.306

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=FARNESYL-PP&oldid=138689"