Difference between revisions of "FARNESYL-PP"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17888 RXN-17888] == * direction: ** left-to-right * common-name: ** arginyl-trna--protein trans...") |
(Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * smiles: ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c * inchi-k...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite FARNESYL-PP == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** (2e,6e)-farnesyl diphosphate |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c |
− | == Reaction | + | * inchi-key: |
− | * | + | ** vwfjdquyciwhtn-yfvjmotdsa-k |
− | + | * molecular-weight: | |
− | * | + | ** 379.306 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[2.5.1.58-RXN]] |
− | == | + | * [[FARNESYLTRANSTRANSFERASE-RXN]] |
− | * [[ | + | * [[GGPS]] |
− | * | + | * [[HEMEOSYN-RXN]] |
− | + | * [[RXN-11963]] | |
− | + | * [[RXN-12263]] | |
− | == | + | * [[RXN-13162]] |
− | + | * [[RXN-17573]] | |
− | {{#set: common-name= | + | * [[RXN-8999]] |
− | {{#set: | + | * [[RXN-9969]] |
− | {{#set: | + | * [[RXN0-5180]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.5.1.58-RXN]] | |
− | + | * [[FPPS]] | |
− | + | * [[FPPSYN-RXN]] | |
− | + | * [[RXN-11963]] | |
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=(2e,6e)-farnesyl diphosphate}} | ||
+ | {{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}} | ||
+ | {{#set: molecular-weight=379.306}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite FARNESYL-PP
- common-name:
- (2e,6e)-farnesyl diphosphate
- smiles:
- cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
- inchi-key:
- vwfjdquyciwhtn-yfvjmotdsa-k
- molecular-weight:
- 379.306
Reaction(s) known to consume the compound
- 2.5.1.58-RXN
- FARNESYLTRANSTRANSFERASE-RXN
- GGPS
- HEMEOSYN-RXN
- RXN-11963
- RXN-12263
- RXN-13162
- RXN-17573
- RXN-8999
- RXN-9969
- RXN0-5180