Difference between revisions of "FARNESYL-PP"

Latest revision as of 11:15, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite Nucleoside-Diphosphates ==
+== Metabolite FARNESYL-PP ==
 * common-name:
-** a nucleoside diphosphate
+** (2e,6e)-farnesyl diphosphate
+* smiles:
+** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
+* inchi-key:
+** vwfjdquyciwhtn-yfvjmotdsa-k
+* molecular-weight:
+** 379.306
 == Reaction(s) known to consume the compound ==
-* [[2.7.4.10-RXN]]
+* [[2.5.1.58-RXN]]
-* [[2.7.7.8-RXN]]
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
-* [[NUCLEOSIDE-DIP-KIN-RXN]]
+* [[GGPS]]
-* [[NUCLEOSIDE-DIPHOSPHATASE-RXN]]
+* [[HEMEOSYN-RXN]]
+* [[RXN-11963]]
+* [[RXN-12263]]
+* [[RXN-13162]]
+* [[RXN-17573]]
+* [[RXN-8999]]
+* [[RXN-9969]]
+* [[RXN0-5180]]
 == Reaction(s) known to produce the compound ==
-* [[2.7.4.10-RXN]]
+* [[2.5.1.58-RXN]]
-* [[2.7.7.8-RXN]]
+* [[FPPS]]
-* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+* [[FPPSYN-RXN]]
+* [[RXN-11963]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=a nucleoside diphosphate}}
+{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
+{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}
+{{#set: molecular-weight=379.306}}