Difference between revisions of "FARNESYL-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT ACACT] == * direction: ** left-to-right * common-name: ** acetyl-coa c-acetyltransferase == R...")
 
(Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * smiles: ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c * inchi-k...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT ACACT] ==
+
== Metabolite FARNESYL-PP ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** acetyl-coa c-acetyltransferase
+
** (2e,6e)-farnesyl diphosphate
== Reaction formula ==
+
* smiles:
* 2.0 [[ACETYL-COA]][c] '''=>''' 1.0 [[ACETOACETYL-COA]][c] '''+''' 1.0 [[CO-A]][c]
+
** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ14898]]
+
** vwfjdquyciwhtn-yfvjmotdsa-k
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 379.306
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[2.5.1.58-RXN]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
== External links  ==
+
* [[GGPS]]
{{#set: direction=left-to-right}}
+
* [[HEMEOSYN-RXN]]
{{#set: common-name=acetyl-coa c-acetyltransferase}}
+
* [[RXN-11963]]
{{#set: nb gene associated=1}}
+
* [[RXN-12263]]
{{#set: nb pathway associated=0}}
+
* [[RXN-13162]]
{{#set: reconstruction category=orthology}}
+
* [[RXN-17573]]
{{#set: reconstruction tool=pantograph}}
+
* [[RXN-8999]]
{{#set: reconstruction comment=n.a}}
+
* [[RXN-9969]]
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
* [[RXN0-5180]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[2.5.1.58-RXN]]
 +
* [[FPPS]]
 +
* [[FPPSYN-RXN]]
 +
* [[RXN-11963]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
 +
{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}
 +
{{#set: molecular-weight=379.306}}

Latest revision as of 11:15, 18 March 2021

Metabolite FARNESYL-PP

  • common-name:
    • (2e,6e)-farnesyl diphosphate
  • smiles:
    • cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
  • inchi-key:
    • vwfjdquyciwhtn-yfvjmotdsa-k
  • molecular-weight:
    • 379.306

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality