Difference between revisions of "GALACTITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...")
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14873 ==
+
== Metabolite D-ALA-D-ALA ==
 
* common-name:
 
* common-name:
** 3-amino-4-hydroxybenzoate
+
** d-alanyl-d-alanine
 
* smiles:
 
* smiles:
** c(=o)([o-])c1(c=c(n)c(o)=cc=1)
+
** cc([n+])c(=o)nc(c)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** mrbkrzapgucwos-uhfffaoysa-m
+
** defjqiddeaulhb-qwwzwvqmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 152.129
+
** 160.172
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15414]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DALADALALIG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-amino-4-hydroxybenzoate}}
+
{{#set: common-name=d-alanyl-d-alanine}}
{{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}}
{{#set: molecular-weight=152.129}}
+
{{#set: molecular-weight=160.172}}

Revision as of 11:17, 15 January 2021

Metabolite D-ALA-D-ALA

  • common-name:
    • d-alanyl-d-alanine
  • smiles:
    • cc([n+])c(=o)nc(c)c([o-])=o
  • inchi-key:
    • defjqiddeaulhb-qwwzwvqmsa-n
  • molecular-weight:
    • 160.172

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality