Difference between revisions of "GALACTITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...")
(Created page with "Category:metabolite == Metabolite GALACTITOL == * common-name: ** galactitol * smiles: ** c(c(c(c(c(o)co)o)o)o)o * inchi-key: ** fbpfztcfmrresa-gucujzijsa-n * molecular-we...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-ALA-D-ALA ==
+
== Metabolite GALACTITOL ==
 
* common-name:
 
* common-name:
** d-alanyl-d-alanine
+
** galactitol
 
* smiles:
 
* smiles:
** cc([n+])c(=o)nc(c)c([o-])=o
+
** c(c(c(c(c(o)co)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** defjqiddeaulhb-qwwzwvqmsa-n
+
** fbpfztcfmrresa-gucujzijsa-n
 
* molecular-weight:
 
* molecular-weight:
** 160.172
+
** 182.173
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12078]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DALADALALIG-RXN]]
+
* [[RXN-12078]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-alanyl-d-alanine}}
+
{{#set: common-name=galactitol}}
{{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}}
+
{{#set: inchi-key=inchikey=fbpfztcfmrresa-gucujzijsa-n}}
{{#set: molecular-weight=160.172}}
+
{{#set: molecular-weight=182.173}}

Latest revision as of 11:15, 18 March 2021

Metabolite GALACTITOL

  • common-name:
    • galactitol
  • smiles:
    • c(c(c(c(c(o)co)o)o)o)o
  • inchi-key:
    • fbpfztcfmrresa-gucujzijsa-n
  • molecular-weight:
    • 182.173

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality