Difference between revisions of "GLYOX"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-Disulfides == * common-name: ** a protein disulfide == Reaction(s) known to consume the compound == * 1.6.4.4-RXN * HDS =...")
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=ccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-Disulfides ==
+
== Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ ==
 
* common-name:
 
* common-name:
** a protein disulfide
+
** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** hdsgdgslnmimku-kfsstaeesa-n
 +
* molecular-weight:
 +
** 699.111
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.6.4.4-RXN]]
 
* [[HDS]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.11.1.15-RXN]]
+
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
* [[1.6.4.4-RXN]]
 
* [[HDS]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a protein disulfide}}
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}}
 +
{{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}}
 +
{{#set: molecular-weight=699.111}}

Revision as of 08:31, 15 March 2021

Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • hdsgdgslnmimku-kfsstaeesa-n
  • molecular-weight:
    • 699.111

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality