Difference between revisions of "GTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Purine-Ribonucleosides == * common-name: ** a purine ribonucleoside == Reaction(s) known to consume the compound == * PNP-RXN * PUR...")
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Purine-Ribonucleosides ==
+
== Metabolite GTP ==
 
* common-name:
 
* common-name:
** a purine ribonucleoside
+
** gtp
 +
* smiles:
 +
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 +
* inchi-key:
 +
** xkmlyualxhknft-uuokfmhzsa-j
 +
* molecular-weight:
 +
** 519.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PNP-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[PURINE-NUCLEOSIDASE-RXN]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
* [[RXN-7001]]
+
* [[FE2GTPabc]]
 +
* [[GTCY]]
 +
* [[GTP-CYCLOHYDRO-I-RXN]]
 +
* [[GTP-CYCLOHYDRO-II-RXN]]
 +
* [[GTPPYPHOSKIN-RXN]]
 +
* [[GTUP]]
 +
* [[GUANYLCYC-RXN]]
 +
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 +
* [[NTDP]]
 +
* [[RXN-12502]]
 +
* [[RXN-12504]]
 +
* [[RXN-14140]]
 +
* [[RXN-14201]]
 +
* [[RXN-15713]]
 +
* [[RXN-17921]]
 +
* [[RXN-8340]]
 +
* [[RXN-8988]]
 +
* [[RXN0-5462]]
 +
* [[RXN0-746]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[URKI-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PNP-RXN]]
+
* [[3.6.1.17-RXN]]
 +
* [[ATGD]]
 +
* [[GDPKIN-RXN]]
 +
* [[GTPOP]]
 +
* [[RXN-14117]]
 +
* [[RXN0-6427]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a purine ribonucleoside}}
+
{{#set: common-name=gtp}}
 +
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}
 +
{{#set: molecular-weight=519.151}}

Latest revision as of 11:15, 18 March 2021