Difference between revisions of "HCO3"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...")
(Created page with "Category:metabolite == Metabolite HCO3 == * common-name: ** hydrogencarbonate * smiles: ** c([o-])(=o)o * inchi-key: ** bvkzguzccusvtd-uhfffaoysa-m * molecular-weight: **...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XANTHOSINE ==
+
== Metabolite HCO3 ==
 
* common-name:
 
* common-name:
** xanthosine
+
** hydrogencarbonate
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
+
** c([o-])(=o)o
 
* inchi-key:
 
* inchi-key:
** ubortcndukbeop-uuokfmhzsa-n
+
** bvkzguzccusvtd-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 284.228
+
** 61.017
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-363]]
+
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
* [[XANTHOSINEPHOSPHORY-RXN]]
+
* [[BIOTIN-CARBOXYL-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOX-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[R524-RXN]]
 +
* [[RXN-12893]]
 +
* [[RXN-13202]]
 +
* [[RXN-14569]]
 +
* [[RXN-16909]]
 +
* [[RXN0-5224]]
 +
* [[RXN1G-4355]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[X5NT]]
+
* [[1.2.1.27-RXN]]
* [[XMPXAN-RXN]]
+
* [[ACOACXr]]
 +
* [[PCr]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[RXN-11213]]
 +
* [[RXN-14569]]
 +
* [[RXN0-5224]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xanthosine}}
+
{{#set: common-name=hydrogencarbonate}}
{{#set: inchi-key=inchikey=ubortcndukbeop-uuokfmhzsa-n}}
+
{{#set: inchi-key=inchikey=bvkzguzccusvtd-uhfffaoysa-m}}
{{#set: molecular-weight=284.228}}
+
{{#set: molecular-weight=61.017}}

Latest revision as of 11:10, 18 March 2021