Difference between revisions of "IMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17148 == * transcription-direction: ** negative * right-end-position: ** 97257 * left-end-position: ** 77119 * centisome-position: ** 28.521818...")
(Created page with "Category:metabolite == Metabolite IMP == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** grszfwquakgdav-kqy...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17148 ==
+
== Metabolite IMP ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** imp
−
* right-end-position:
+
* smiles:
−
** 97257
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
−
* left-end-position:
+
* inchi-key:
−
** 77119
+
** grszfwquakgdav-kqynxxcusa-l
−
* centisome-position:
+
* molecular-weight:
−
** 28.521818   
+
** 346.193
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
−
== Reaction(s) associated ==
+
* [[HPRT]]
−
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
+
* [[I5NT]]
−
** Category: [[annotation]]
+
* [[IMP-DEHYDROG-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[IMPCYCLOHYDROLASE-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-7607]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) associated ==
+
* [[AMP-DEAMINASE-RXN]]
−
* [[PWY-6352]]
+
* [[GMP-REDUCT-RXN]]
−
** '''5''' reactions found over '''8''' reactions in the full pathway
+
* [[HPRT]]
−
{{#set: transcription-direction=negative}}
+
* [[HYPOXANPRIBOSYLTRAN-RXN]]
−
{{#set: right-end-position=97257}}
+
* [[IMP-DEHYDROG-RXN]]
−
{{#set: left-end-position=77119}}
+
* [[IMPCYCLOHYDROLASE-RXN]]
−
{{#set: centisome-position=28.521818    }}
+
* [[ITPP]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-14003]]
−
{{#set: nb reaction associated=1}}
+
* [[RXN0-6382]]
−
{{#set: nb pathway associated=1}}
+
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=imp}}
 +
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
 +
{{#set: molecular-weight=346.193}}

Latest revision as of 11:12, 18 March 2021

Metabolite IMP

  • common-name:
    • imp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • grszfwquakgdav-kqynxxcusa-l
  • molecular-weight:
    • 346.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=IMP&oldid=137274"