Difference between revisions of "IMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09981 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...")
(Created page with "Category:metabolite == Metabolite IMP == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** grszfwquakgdav-kqy...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09981 ==
+
== Metabolite IMP ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** imp
== Reaction(s) associated ==
+
* smiles:
* [[PROTEIN-KINASE-RXN]]
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** grszfwquakgdav-kqynxxcusa-l
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 346.193
 +
== Reaction(s) known to consume the compound ==
 +
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 +
* [[HPRT]]
 +
* [[I5NT]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
* [[RXN-7607]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[AMP-DEAMINASE-RXN]]
 +
* [[GMP-REDUCT-RXN]]
 +
* [[HPRT]]
 +
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
* [[ITPP]]
 +
* [[RXN-14003]]
 +
* [[RXN0-6382]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=imp}}
 +
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
 +
{{#set: molecular-weight=346.193}}

Latest revision as of 11:12, 18 March 2021

Metabolite IMP

  • common-name:
    • imp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • grszfwquakgdav-kqynxxcusa-l
  • molecular-weight:
    • 346.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality