Difference between revisions of "IMP"

Latest revision as of 11:12, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite Protein-tyrosine-phosphates ==
+== Metabolite IMP ==
 * common-name:
-** a [protein]-l-tyrosine phosphate
+** imp
+* smiles:
+** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+* inchi-key:
+** grszfwquakgdav-kqynxxcusa-l
+* molecular-weight:
+** 346.193
 == Reaction(s) known to consume the compound ==
-* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
+* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+* [[HPRT]]
+* [[I5NT]]
+* [[IMP-DEHYDROG-RXN]]
+* [[IMPCYCLOHYDROLASE-RXN]]
+* [[RXN-7607]]
 == Reaction(s) known to produce the compound ==
-* [[2.7.10.1-RXN]]
+* [[AMP-DEAMINASE-RXN]]
+* [[GMP-REDUCT-RXN]]
+* [[HPRT]]
+* [[HYPOXANPRIBOSYLTRAN-RXN]]
+* [[IMP-DEHYDROG-RXN]]
+* [[IMPCYCLOHYDROLASE-RXN]]
+* [[ITPP]]
+* [[RXN-14003]]
+* [[RXN0-6382]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=a [protein]-l-tyrosine phosphate}}
+{{#set: common-name=imp}}
+{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
+{{#set: molecular-weight=346.193}}