Difference between revisions of "IMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8082 == * common-name: ** 1-18:2-2-18:2-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c...")
(Created page with "Category:metabolite == Metabolite IMP == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** grszfwquakgdav-kqy...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8082 ==
+
== Metabolite IMP ==
 
* common-name:
 
* common-name:
** 1-18:2-2-18:2-digalactosyldiacylglycerol
+
** imp
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
* inchi-key:
 
* inchi-key:
** muubilnsvlplll-mezujybgsa-n
+
** grszfwquakgdav-kqynxxcusa-l
 
* molecular-weight:
 
* molecular-weight:
** 941.247
+
** 346.193
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8310]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
* [[RXN-8313]]
+
* [[HPRT]]
 +
* [[I5NT]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
* [[RXN-7607]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[AMP-DEAMINASE-RXN]]
 +
* [[GMP-REDUCT-RXN]]
 +
* [[HPRT]]
 +
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
* [[ITPP]]
 +
* [[RXN-14003]]
 +
* [[RXN0-6382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-18:2-digalactosyldiacylglycerol}}
+
{{#set: common-name=imp}}
{{#set: inchi-key=inchikey=muubilnsvlplll-mezujybgsa-n}}
+
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
{{#set: molecular-weight=941.247}}
+
{{#set: molecular-weight=346.193}}

Latest revision as of 11:12, 18 March 2021

Metabolite IMP

  • common-name:
    • imp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • grszfwquakgdav-kqynxxcusa-l
  • molecular-weight:
    • 346.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality