Difference between revisions of "L-ASPARTATE"

Revision as of 08:25, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP ==
+== Metabolite IMP ==
 * common-name:
-** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
+** imp
 * smiles:
-** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
+** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 * inchi-key:
-** agqjqcfepuvxnk-uhfffaoysa-k
+** grszfwquakgdav-kqynxxcusa-l
 * molecular-weight:
-** 296.093
+** 346.193
 == Reaction(s) known to consume the compound ==
-* [[RXN-12610]]
+* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
-* [[RXN-12611]]
+* [[HPRT]]
-* [[THI-P-SYN-RXN]]
+* [[I5NT]]
+* [[IMP-DEHYDROG-RXN]]
+* [[IMPCYCLOHYDROLASE-RXN]]
+* [[RXN-7607]]
 == Reaction(s) known to produce the compound ==
-* [[PYRIMSYN3-RXN]]
+* [[AMP-DEAMINASE-RXN]]
+* [[GMP-REDUCT-RXN]]
+* [[HPRT]]
+* [[HYPOXANPRIBOSYLTRAN-RXN]]
+* [[IMP-DEHYDROG-RXN]]
+* [[IMPCYCLOHYDROLASE-RXN]]
+* [[ITPP]]
+* [[RXN-14003]]
+* [[RXN0-6382]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-amino-2-methyl-5-(diphosphomethyl)pyrimidine}}
+{{#set: common-name=imp}}
-{{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}}
+{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
-{{#set: molecular-weight=296.093}}
+{{#set: molecular-weight=346.193}}