Difference between revisions of "L-ASPARTATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11641 == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) * inchi-...")
(Created page with "Category:metabolite == Metabolite L-ASPARTATE == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)[o-] * inchi-key: ** ckljmwtzizzhcs-reohclbhsa-m * mole...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11641 ==
+
== Metabolite L-ASPARTATE ==
 
* common-name:
 
* common-name:
** 4-methylumbelliferyl glucoside
+
** l-aspartate
 
* smiles:
 
* smiles:
** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3))
+
** c(c(=o)[o-])c([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** yudptgpsbjvhcn-ymiltqatsa-n
+
** ckljmwtzizzhcs-reohclbhsa-m
 
* molecular-weight:
 
* molecular-weight:
** 338.313
+
** 132.096
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10769]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 +
* [[ARGSUCCINSYN-RXN]]
 +
* [[ASNSYNA-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ASPCARBTRANS-RXN]]
 +
* [[L-ASPARTATE-OXID-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 +
* [[RXN-10]]
 +
* [[RXN-13697]]
 +
* [[RXN-9772]]
 +
* [[SAICARSYN-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.4.11.21-RXN]]
 +
* [[3.5.1.26-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[ASPARAGHYD-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ASPCARBTRANS-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN0-6975]]
 +
* [[RXN0-6987]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-methylumbelliferyl glucoside}}
+
{{#set: common-name=l-aspartate}}
{{#set: inchi-key=inchikey=yudptgpsbjvhcn-ymiltqatsa-n}}
+
{{#set: inchi-key=inchikey=ckljmwtzizzhcs-reohclbhsa-m}}
{{#set: molecular-weight=338.313}}
+
{{#set: molecular-weight=132.096}}

Latest revision as of 11:12, 18 March 2021