Difference between revisions of "L-ASPARTATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22454 == * transcription-direction: ** negative * right-end-position: ** 371224 * left-end-position: ** 365577 * centisome-position: ** 63.293625...") |
(Created page with "Category:metabolite == Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P == * common-name: ** 5-enolpyruvoyl-shikimate 3-phosphate * smiles: ** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P == |
− | * | + | * common-name: |
− | ** | + | ** 5-enolpyruvoyl-shikimate 3-phosphate |
− | * | + | * smiles: |
− | ** | + | ** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** qutykixiudqolk-prjmdxoysa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 320.149 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2.5.1.19-RXN]] |
− | == Reaction(s) | + | * [[CHORISMATE-SYNTHASE-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[2.5.1.19-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=5-enolpyruvoyl-shikimate 3-phosphate}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=qutykixiudqolk-prjmdxoysa-j}} |
− | + | {{#set: molecular-weight=320.149}} | |
− | {{#set: | ||
− | |||
− |
Revision as of 20:31, 18 December 2020
Contents
Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P
- common-name:
- 5-enolpyruvoyl-shikimate 3-phosphate
- smiles:
- c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1)
- inchi-key:
- qutykixiudqolk-prjmdxoysa-j
- molecular-weight:
- 320.149