Difference between revisions of "L-ASPARTATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17813 == * common-name: ** (2e,11z)-hexadec-2,11-dienoyl-coa * smiles: ** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o...")
(Created page with "Category:metabolite == Metabolite CPD-11641 == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) * inchi-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17813 ==
+
== Metabolite CPD-11641 ==
 
* common-name:
 
* common-name:
** (2e,11z)-hexadec-2,11-dienoyl-coa
+
** 4-methylumbelliferyl glucoside
 
* smiles:
 
* smiles:
** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+
** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3))
 
* inchi-key:
 
* inchi-key:
** amssmxhtrodksm-fyyfncousa-j
+
** yudptgpsbjvhcn-ymiltqatsa-n
 
* molecular-weight:
 
* molecular-weight:
** 997.883
+
** 338.313
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16558]]
+
* [[RXN-10769]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,11z)-hexadec-2,11-dienoyl-coa}}
+
{{#set: common-name=4-methylumbelliferyl glucoside}}
{{#set: inchi-key=inchikey=amssmxhtrodksm-fyyfncousa-j}}
+
{{#set: inchi-key=inchikey=yudptgpsbjvhcn-ymiltqatsa-n}}
{{#set: molecular-weight=997.883}}
+
{{#set: molecular-weight=338.313}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-11641

  • common-name:
    • 4-methylumbelliferyl glucoside
  • smiles:
    • cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3))
  • inchi-key:
    • yudptgpsbjvhcn-ymiltqatsa-n
  • molecular-weight:
    • 338.313

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality