Difference between revisions of "L-DEHYDRO-ASCORBATE"

Latest revision as of 11:12, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-10332 ==
+== Metabolite L-DEHYDRO-ASCORBATE ==
 * common-name:
-** gibberellin44 (open lactone form)
+** l-dehydro-ascorbate
 * smiles:
-** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
+** c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
 * inchi-key:
-** axeuuxhmkspqai-ytjhipewsa-l
+** sbjkkffyizucet-szscbosdsa-n
 * molecular-weight:
-** 362.422
+** 174.11
 == Reaction(s) known to consume the compound ==
-* [[RXN1F-168]]
+* [[1.8.5.1-RXN]]
+* [[RXN-13185]]
 == Reaction(s) known to produce the compound ==
-* [[RXN1F-167]]
+* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+* [[ETHYL-RXN]]
+* [[RXN-12440]]
+* [[RXN-13185]]
+* [[RXN-19200]]
+* [[RXN-7984]]
+* [[RXN-7985]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=gibberellin44 (open lactone form)}}
+{{#set: common-name=l-dehydro-ascorbate}}
-{{#set: inchi-key=inchikey=axeuuxhmkspqai-ytjhipewsa-l}}
+{{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}}
-{{#set: molecular-weight=362.422}}
+{{#set: molecular-weight=174.11}}