Difference between revisions of "L-DEHYDRO-ASCORBATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02288 == * transcription-direction: ** positive * right-end-position: ** 75241 * left-end-position: ** 67460 * centisome-position: ** 48.57151...")
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * inchi-key: ** sbjkkffyizucet-sz...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02288 ==
+
== Metabolite L-DEHYDRO-ASCORBATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** l-dehydro-ascorbate
−
* right-end-position:
+
* smiles:
−
** 75241
+
** c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
−
* left-end-position:
+
* inchi-key:
−
** 67460
+
** sbjkkffyizucet-szscbosdsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 48.57151   
+
** 174.11
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.8.5.1-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-13185]]
−
* [[R524-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ETHYL-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-12440]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-13185]]
−
* [[RXN-12893]]
+
* [[RXN-19200]]
−
** Category: [[annotation]]
+
* [[RXN-7984]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7985]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=l-dehydro-ascorbate}}
−
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}}
−
* [[CYANCAT-PWY]]
+
{{#set: molecular-weight=174.11}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=75241}}
 
−
{{#set: left-end-position=67460}}
 
−
{{#set: centisome-position=48.57151    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite L-DEHYDRO-ASCORBATE

  • common-name:
    • l-dehydro-ascorbate
  • smiles:
    • c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
  • inchi-key:
    • sbjkkffyizucet-szscbosdsa-n
  • molecular-weight:
    • 174.11

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-DEHYDRO-ASCORBATE&oldid=137354"