Difference between revisions of "L-DEHYDRO-ASCORBATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02288 == * transcription-direction: ** positive * right-end-position: ** 75241 * left-end-position: ** 67460 * centisome-position: ** 48.57151...") |
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * inchi-key: ** sbjkkffyizucet-sz...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-DEHYDRO-ASCORBATE == |
− | * | + | * common-name: |
− | ** | + | ** l-dehydro-ascorbate |
− | * | + | * smiles: |
− | ** | + | ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) |
− | * | + | * inchi-key: |
− | ** | + | ** sbjkkffyizucet-szscbosdsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 174.11 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[1.8.5.1-RXN]] |
− | == Reaction(s) | + | * [[RXN-13185]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] |
− | * | + | * [[ETHYL-RXN]] |
− | * | + | * [[RXN-12440]] |
− | * | + | * [[RXN-13185]] |
− | * [[RXN- | + | * [[RXN-19200]] |
− | * | + | * [[RXN-7984]] |
− | + | * [[RXN-7985]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=l-dehydro-ascorbate}} | |
− | == | + | {{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}} |
− | + | {{#set: molecular-weight=174.11}} | |
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite L-DEHYDRO-ASCORBATE
- common-name:
- l-dehydro-ascorbate
- smiles:
- c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
- inchi-key:
- sbjkkffyizucet-szscbosdsa-n
- molecular-weight:
- 174.11