Difference between revisions of "LAUROYLCOA-CPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7088 == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) * inchi-ke...")
(Created page with "Category:metabolite == Metabolite LAUROYLCOA-CPD == * common-name: ** lauroyl-coa * smiles: ** cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7088 ==
+
== Metabolite LAUROYLCOA-CPD ==
 
* common-name:
 
* common-name:
** (2r,3s,4s)-leucodelphinidin
+
** lauroyl-coa
 
* smiles:
 
* smiles:
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
+
** cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** zeacokjoqlaytd-souvjxgzsa-n
+
** ymcxghlsvalicc-gmhmeamdsa-j
 
* molecular-weight:
 
* molecular-weight:
** 322.271
+
** 945.808
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACACT6]]
 +
* [[ACACT6h]]
 +
* [[ACOA120OR]]
 +
* [[RXN-14262]]
 +
* [[RXN-9627]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7784]]
+
* [[ACACT6]]
 +
* [[RXN-14262]]
 +
* [[RXN-14268]]
 +
* [[RXN-16393]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r,3s,4s)-leucodelphinidin}}
+
{{#set: common-name=lauroyl-coa}}
{{#set: inchi-key=inchikey=zeacokjoqlaytd-souvjxgzsa-n}}
+
{{#set: inchi-key=inchikey=ymcxghlsvalicc-gmhmeamdsa-j}}
{{#set: molecular-weight=322.271}}
+
{{#set: molecular-weight=945.808}}

Latest revision as of 11:11, 18 March 2021

Metabolite LAUROYLCOA-CPD

  • common-name:
    • lauroyl-coa
  • smiles:
    • cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ymcxghlsvalicc-gmhmeamdsa-j
  • molecular-weight:
    • 945.808

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality