Difference between revisions of "LAUROYLCOA-CPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-Phospho-DNA == * common-name: ** a 5'-phospho-[dna] == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-5-HYDROXYL-KINAS...")
(Created page with "Category:metabolite == Metabolite CPD-7088 == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) * inchi-ke...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-Phospho-DNA ==
+
== Metabolite CPD-7088 ==
 
* common-name:
 
* common-name:
** a 5'-phospho-[dna]
+
** (2r,3s,4s)-leucodelphinidin
 +
* smiles:
 +
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
 +
* inchi-key:
 +
** zeacokjoqlaytd-souvjxgzsa-n
 +
* molecular-weight:
 +
** 322.271
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]]
+
* [[RXN-7784]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5'-phospho-[dna]}}
+
{{#set: common-name=(2r,3s,4s)-leucodelphinidin}}
 +
{{#set: inchi-key=inchikey=zeacokjoqlaytd-souvjxgzsa-n}}
 +
{{#set: molecular-weight=322.271}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-7088

  • common-name:
    • (2r,3s,4s)-leucodelphinidin
  • smiles:
    • c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
  • inchi-key:
    • zeacokjoqlaytd-souvjxgzsa-n
  • molecular-weight:
    • 322.271

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality