Difference between revisions of "MALTOHEXAOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OLIGOPEPTIDES == * common-name: ** an oligopeptide == Reaction(s) known to consume the compound == * 3.4.16.2-RXN * 3.4.21.83-RXN...")
(Created page with "Category:metabolite == Metabolite MALTOHEXAOSE == * common-name: ** maltohexaose * smiles: ** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OLIGOPEPTIDES ==
+
== Metabolite MALTOHEXAOSE ==
 
* common-name:
 
* common-name:
** an oligopeptide
+
** maltohexaose
 +
* smiles:
 +
** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o
 +
* inchi-key:
 +
** ocibbxpluvykch-liggpisvsa-n
 +
* molecular-weight:
 +
** 990.867
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.16.2-RXN]]
+
* [[RXN-14282]]
* [[3.4.21.83-RXN]]
+
* [[RXN-14285]]
* [[3.4.24.70-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14283]]
 +
* [[RXN-14286]]
 +
* [[RXN0-5181]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an oligopeptide}}
+
{{#set: common-name=maltohexaose}}
 +
{{#set: inchi-key=inchikey=ocibbxpluvykch-liggpisvsa-n}}
 +
{{#set: molecular-weight=990.867}}

Latest revision as of 11:11, 18 March 2021

Metabolite MALTOHEXAOSE

  • common-name:
    • maltohexaose
  • smiles:
    • c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o
  • inchi-key:
    • ocibbxpluvykch-liggpisvsa-n
  • molecular-weight:
    • 990.867

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality