Difference between revisions of "MALTOHEXAOSE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04338 == * transcription-direction: ** negative * right-end-position: ** 750420 * left-end-position: ** 740606 * centisome-position: ** 76.102356...") |
(Created page with "Category:metabolite == Metabolite MALTOHEXAOSE == * common-name: ** maltohexaose * smiles: ** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite MALTOHEXAOSE == |
| − | * | + | * common-name: |
| − | ** | + | ** maltohexaose |
| − | * | + | * smiles: |
| − | ** | + | ** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o |
| − | * | + | * inchi-key: |
| − | ** | + | ** ocibbxpluvykch-liggpisvsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 990.867 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-14282]] |
| − | == Reaction(s) | + | * [[RXN-14285]] |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[RXN-14283]] |
| − | + | * [[RXN-14286]] | |
| − | * [[ | + | * [[RXN0-5181]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=maltohexaose}} | |
| − | + | {{#set: inchi-key=inchikey=ocibbxpluvykch-liggpisvsa-n}} | |
| − | + | {{#set: molecular-weight=990.867}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite MALTOHEXAOSE
- common-name:
- maltohexaose
- smiles:
- c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o
- inchi-key:
- ocibbxpluvykch-liggpisvsa-n
- molecular-weight:
- 990.867
