Difference between revisions of "Main Page"

Revision as of 08:32, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 2-TRANS6-TRANS-FARNESAL ==
+== Metabolite G3P ==
 * common-name:
-** (2e,6e)-farnesal
+** 3-phospho-d-glycerate
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=c[ch]=o
+** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
 * inchi-key:
-** yhruhbbtqzkmex-yfvjmotdsa-n
+** osjppgntcrnqqc-uwtatzphsa-k
 * molecular-weight:
-** 220.354
+** 183.034
 == Reaction(s) known to consume the compound ==
+* [[3PGAREARR-RXN]]
+* [[PGLYCDEHYDROG-RXN]]
+* [[PHOSGLYPHOS-RXN]]
+* [[RXN-15511]]
+* [[RXN-15513]]
+* [[RXN-17276]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-11623]]
+* [[3PGAREARR-RXN]]
+* [[GLY3KIN-RXN]]
+* [[PGLYCDEHYDROG-RXN]]
+* [[PHOSGLYPHOS-RXN]]
+* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
+* [[RXN-15511]]
+* [[RXN-15513]]
+* [[RXN-17274]]
+* [[RXN-3443]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,6e)-farnesal}}
+{{#set: common-name=3-phospho-d-glycerate}}
-{{#set: inchi-key=inchikey=yhruhbbtqzkmex-yfvjmotdsa-n}}
+{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}
-{{#set: molecular-weight=220.354}}
+{{#set: molecular-weight=183.034}}