|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARGDECARBOX-RXN ARGDECARBOX-RXN] == | + | == Metabolite CPD-12116 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** arginine decarboxylase, biosynthetic | + | ** demethylmenaquinol-6 |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/4.1.1.19 ec-4.1.1.19] | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ARG]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[AGMATHINE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
| + | ** ufaxpzazhzpelj-rotsudqpsa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ12405]]
| + | ** 568.881 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-9220]] |
| − | == Pathway(s) ==
| + | == Reaction(s) known to produce the compound == |
| − | * [[PWY-6305]], putrescine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305] | + | == Reaction(s) of unknown directionality == |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway | + | {{#set: common-name=demethylmenaquinol-6}} |
| − | * [[PWY0-1299]], arginine dependent acid resistance: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1299 PWY0-1299]
| + | {{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}} |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | {{#set: molecular-weight=568.881}} |
| − | * [[PWY-40]], putrescine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-40 PWY-40] | |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[PWY-6834]], spermidine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6834 PWY-6834]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[ARGDEG-III-PWY]], L-arginine degradation IV (arginine decarboxylase/agmatine deiminase pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARGDEG-III-PWY ARGDEG-III-PWY]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY0-823]], L-arginine degradation III (arginine decarboxylase/agmatinase pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-823 PWY0-823]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-43]], putrescine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-43 PWY-43]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17644 17644]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00566 R00566]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P21170 P21170]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PPF5 Q9PPF5]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JT25 Q9JT25]
| |
| − | ** [http://www.uniprot.org/uniprot/P49726 P49726]
| |
| − | ** [http://www.uniprot.org/uniprot/P22220 P22220]
| |
| − | ** [http://www.uniprot.org/uniprot/P28629 P28629]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43075 Q43075]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9SI64 Q9SI64]
| |
| − | ** [http://www.uniprot.org/uniprot/P72587 P72587]
| |
| − | ** [http://www.uniprot.org/uniprot/P74576 P74576]
| |
| − | ** [http://www.uniprot.org/uniprot/O24128 O24128]
| |
| − | ** [http://www.uniprot.org/uniprot/O23141 O23141]
| |
| − | ** [http://www.uniprot.org/uniprot/Q39827 Q39827]
| |
| − | ** [http://www.uniprot.org/uniprot/O81161 O81161]
| |
| − | ** [http://www.uniprot.org/uniprot/O04429 O04429]
| |
| − | ** [http://www.uniprot.org/uniprot/Q96412 Q96412]
| |
| − | ** [http://www.uniprot.org/uniprot/O81177 O81177]
| |
| − | ** [http://www.uniprot.org/uniprot/O64453 O64453]
| |
| − | </div>
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=arginine decarboxylase, biosynthetic}} | |
| − | {{#set: ec-number=ec-4.1.1.19}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=7}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
