Difference between revisions of "CPD-10792"

From metabolic_network
Jump to navigation Jump to search
(Created page with "{{#ask: Category:reaction reconstruction tool::curation | ?common-name | ?ec-number | ?reconstruction category | ?reconstruction source | ?reconstruction comment | ?nb...")
(Created page with "Category:metabolite == Metabolite CARNITINE == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c * inchi-key: ** phiqhxfuzvpyii-zcfiwibfsa-n * molecu...")
Line 1: Line 1:
{{#ask: [[Category:reaction]] [[reconstruction tool::curation]]
+
[[Category:metabolite]]
| ?common-name
+
== Metabolite CARNITINE ==
| ?ec-number
+
* common-name:
| ?reconstruction category
+
** l-carnitine
| ?reconstruction source
+
* smiles:
| ?reconstruction comment
+
** c(c(o)cc(=o)[o-])[n+](c)(c)c
| ?nb gene associated
+
* inchi-key:
| ?nb pathway associated
+
** phiqhxfuzvpyii-zcfiwibfsa-n
}}
+
* molecular-weight:
 +
** 161.2
 +
== Reaction(s) known to consume the compound ==
 +
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 +
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
 +
* [[RXN-9918]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[1.14.11.1-RXN]]
 +
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 +
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
 +
* [[RXN-9918]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=l-carnitine}}
 +
{{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}}
 +
{{#set: molecular-weight=161.2}}

Revision as of 13:13, 14 January 2021

Metabolite CARNITINE

  • common-name:
    • l-carnitine
  • smiles:
    • c(c(o)cc(=o)[o-])[n+](c)(c)c
  • inchi-key:
    • phiqhxfuzvpyii-zcfiwibfsa-n
  • molecular-weight:
    • 161.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality