Difference between revisions of "CPD-10792"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:reaction reconstruction tool::curation | ?common-name | ?ec-number | ?reconstruction category | ?reconstruction source | ?reconstruction comment | ?nb...") |
(Created page with "Category:metabolite == Metabolite CARNITINE == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c * inchi-key: ** phiqhxfuzvpyii-zcfiwibfsa-n * molecu...") |
||
Line 1: | Line 1: | ||
− | + | [[Category:metabolite]] | |
− | + | == Metabolite CARNITINE == | |
− | + | * common-name: | |
− | + | ** l-carnitine | |
− | + | * smiles: | |
− | + | ** c(c(o)cc(=o)[o-])[n+](c)(c)c | |
− | + | * inchi-key: | |
− | + | ** phiqhxfuzvpyii-zcfiwibfsa-n | |
− | }} | + | * molecular-weight: |
+ | ** 161.2 | ||
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] | ||
+ | * [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]] | ||
+ | * [[RXN-9918]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[1.14.11.1-RXN]] | ||
+ | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] | ||
+ | * [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]] | ||
+ | * [[RXN-9918]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=l-carnitine}} | ||
+ | {{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}} | ||
+ | {{#set: molecular-weight=161.2}} |
Revision as of 13:13, 14 January 2021
Contents
Metabolite CARNITINE
- common-name:
- l-carnitine
- smiles:
- c(c(o)cc(=o)[o-])[n+](c)(c)c
- inchi-key:
- phiqhxfuzvpyii-zcfiwibfsa-n
- molecular-weight:
- 161.2