Difference between revisions of "NARINGENIN-CMPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANPRIBOSYLTRAN-RXN GUANPRIBOSYLTRAN-RXN] == * direction: ** reversible * common-name: ** guanine...")
(Created page with "Category:metabolite == Metabolite NARINGENIN-CMPD == * common-name: ** (2s)-naringenin * smiles: ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) * inchi-key: ** ftv...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANPRIBOSYLTRAN-RXN GUANPRIBOSYLTRAN-RXN] ==
+
== Metabolite NARINGENIN-CMPD ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** guanine phosphoribosyltransferase
+
** (2s)-naringenin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.2.8 ec-2.4.2.8]
+
** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[GMP]][c] '''+''' 1 [[PPI]][c] '''<=>''' 1 [[GUANINE]][c] '''+''' 1 [[PRPP]][c]
+
** ftvwirxfelqlpi-zdusscgksa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ15126]]
+
** 272.257
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
−
* Gene: [[SJ12523]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[APIGNAR-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=(2s)-naringenin}}
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=272.257}}
−
== Pathway(s) ==
 
−
* [[PWY-6599]], guanine and guanosine salvage II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6599 PWY-6599]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6620]], guanine and guanosine salvage: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6620 PWY-6620]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25427 25427]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01229 R01229]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=guanine phosphoribosyltransferase}}
 
−
{{#set: ec-number=ec-2.4.2.8}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite NARINGENIN-CMPD

  • common-name:
    • (2s)-naringenin
  • smiles:
    • c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
  • inchi-key:
    • ftvwirxfelqlpi-zdusscgksa-n
  • molecular-weight:
    • 272.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=NARINGENIN-CMPD&oldid=138891"