Difference between revisions of "NARINGENIN-CMPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.60-RXN 2.7.7.60-RXN] == * direction: ** left-to-right * common-name: ** 4-diphosphocytidyl-2c...")
(Created page with "Category:metabolite == Metabolite NARINGENIN-CMPD == * common-name: ** (2s)-naringenin * smiles: ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) * inchi-key: ** ftv...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.60-RXN 2.7.7.60-RXN] ==
+
== Metabolite NARINGENIN-CMPD ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 4-diphosphocytidyl-2c-methyl-d-erythritol synthase
+
** (2s)-naringenin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.7.60 ec-2.7.7.60]
+
** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
−
* synonymous:
+
* inchi-key:
−
** 4-diphosphocytidyl-2-methylerithritol synthase (sugar nucleotide phosphorylase family)
+
** ftvwirxfelqlpi-zdusscgksa-n
−
== Reaction formula ==
+
* molecular-weight:
−
* 1 [[2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE]][c] '''+''' 1 [[CTP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[4-CYTIDINE-5-DIPHOSPHO-2-C]][c] '''+''' 1 [[PPI]][c]
+
** 272.257
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ10622]]
+
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[APIGNAR-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=(2s)-naringenin}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=272.257}}
−
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13429 13429]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R05633 R05633]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=4-diphosphocytidyl-2c-methyl-d-erythritol synthase}}
 
−
{{#set: ec-number=ec-2.7.7.60}}
 
−
{{#set: synonymous=4-diphosphocytidyl-2-methylerithritol synthase (sugar nucleotide phosphorylase family)}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite NARINGENIN-CMPD

  • common-name:
    • (2s)-naringenin
  • smiles:
    • c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
  • inchi-key:
    • ftvwirxfelqlpi-zdusscgksa-n
  • molecular-weight:
    • 272.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=NARINGENIN-CMPD&oldid=138891"