Difference between revisions of "NARINGENIN-CMPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-195 == * common-name: ** octanoate * smiles: ** cccccccc(=o)[o-] * inchi-key: ** wwzkqhockizlma-uhfffaoysa-m * molecular-weight: ** 1...")
(Created page with "Category:metabolite == Metabolite NARINGENIN-CMPD == * common-name: ** (2s)-naringenin * smiles: ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) * inchi-key: ** ftv...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-195 ==
+
== Metabolite NARINGENIN-CMPD ==
 
* common-name:
 
* common-name:
** octanoate
+
** (2s)-naringenin
 
* smiles:
 
* smiles:
** cccccccc(=o)[o-]
+
** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
 
* inchi-key:
 
* inchi-key:
** wwzkqhockizlma-uhfffaoysa-m
+
** ftvwirxfelqlpi-zdusscgksa-n
 
* molecular-weight:
 
* molecular-weight:
** 143.205
+
** 272.257
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R223-RXN]]
+
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
* [[RXN0-5098]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
+
* [[APIGNAR-RXN]]
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
 
* [[R222-RXN]]
 
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=octanoate}}
+
{{#set: common-name=(2s)-naringenin}}
{{#set: inchi-key=inchikey=wwzkqhockizlma-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}}
{{#set: molecular-weight=143.205}}
+
{{#set: molecular-weight=272.257}}

Latest revision as of 11:16, 18 March 2021

Metabolite NARINGENIN-CMPD

  • common-name:
    • (2s)-naringenin
  • smiles:
    • c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
  • inchi-key:
    • ftvwirxfelqlpi-zdusscgksa-n
  • molecular-weight:
    • 272.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality