Difference between revisions of "NITRATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CAMP == * common-name: ** cyclic-amp * smiles: ** c3(op(=o)([o-])oc4(c(o)c(n2(c1(=c(c(=nc=n1)n)n=c2)))oc34)) * inchi-key: ** ivomouwhdpkr...") |
(Created page with "Category:metabolite == Metabolite Secondary-Alcohols == * common-name: ** a secondary alcohol == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Secondary-Alcohols == |
* common-name: | * common-name: | ||
− | ** | + | ** a secondary alcohol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[CARBONYL-REDUCTASE-NADPH-RXN]] |
+ | * [[RXN-12448]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[CARBONYL-REDUCTASE-NADPH-RXN]] |
+ | * [[RXN-12448]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a secondary alcohol}} |
− | |||
− |
Revision as of 13:07, 14 January 2021
Contents
Metabolite Secondary-Alcohols
- common-name:
- a secondary alcohol