Difference between revisions of "Nucleoside-Triphosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6994 == * common-name: ** (2s)-eriodictyol * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3)o)o) * inchi-key: ** sbhxy...")
(Created page with "Category:metabolite == Metabolite Nucleoside-Triphosphates == * common-name: ** a nucleoside triphosphate == Reaction(s) known to consume the compound == * [[2.7.4.10-RXN]...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6994 ==
+
== Metabolite Nucleoside-Triphosphates ==
 
* common-name:
 
* common-name:
** (2s)-eriodictyol
+
** a nucleoside triphosphate
* smiles:
 
** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3)o)o)
 
* inchi-key:
 
** sbhxytngizcorc-zdusscgksa-m
 
* molecular-weight:
 
** 287.248
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7775]]
+
* [[2.7.4.10-RXN]]
 +
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
* [[NUCLEOTIDE-PYROPHOSPHATASE-RXN]]
 +
* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
* [[RXN-14024]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.4.10-RXN]]
 +
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
 +
* [[NUCLEOSIDE-DIP-KIN-RXN]]
 +
* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-eriodictyol}}
+
{{#set: common-name=a nucleoside triphosphate}}
{{#set: inchi-key=inchikey=sbhxytngizcorc-zdusscgksa-m}}
 
{{#set: molecular-weight=287.248}}
 

Latest revision as of 11:16, 18 March 2021