Difference between revisions of "O-UREIDOHOMOSERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20617 == * transcription-direction: ** positive * right-end-position: ** 16327 * left-end-position: ** 5397 * centisome-position: ** 0.8753349...")
(Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * common-name: ** o-ureido-l-homoserine * smiles: ** c(cc(c(=o)[o-])[n+])onc(n)=o * inchi-key: ** sfyvzosiaizwqu-vk...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ20617 ==
+
== Metabolite O-UREIDOHOMOSERINE ==
* transcription-direction:
+
* common-name:
** positive
+
** o-ureido-l-homoserine
* right-end-position:
+
* smiles:
** 16327
+
** c(cc(c(=o)[o-])[n+])onc(n)=o
* left-end-position:
+
* inchi-key:
** 5397
+
** sfyvzosiaizwqu-vkhmyheasa-n
* centisome-position:
+
* molecular-weight:
** 0.8753349   
+
** 177.16
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[2.7.10.1-RXN]]
+
* [[RXN-9]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=o-ureido-l-homoserine}}
* [[PROTEIN-KINASE-RXN]]
+
{{#set: inchi-key=inchikey=sfyvzosiaizwqu-vkhmyheasa-n}}
** Category: [[annotation]]
+
{{#set: molecular-weight=177.16}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=16327}}
 
{{#set: left-end-position=5397}}
 
{{#set: centisome-position=0.8753349    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite O-UREIDOHOMOSERINE

  • common-name:
    • o-ureido-l-homoserine
  • smiles:
    • c(cc(c(=o)[o-])[n+])onc(n)=o
  • inchi-key:
    • sfyvzosiaizwqu-vkhmyheasa-n
  • molecular-weight:
    • 177.16

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality