Difference between revisions of "O-UREIDOHOMOSERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite trans-2-cis-5-dienoyl-CoA == * common-name: ** a (2e,5z)-alkan-2,5-dienoyl-coa == Reaction(s) known to consume the compound == * RXN-12...")
(Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * common-name: ** o-ureido-l-homoserine * smiles: ** c(cc(c(=o)[o-])[n+])onc(n)=o * inchi-key: ** sfyvzosiaizwqu-vk...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite trans-2-cis-5-dienoyl-CoA ==
+
== Metabolite O-UREIDOHOMOSERINE ==
 
* common-name:
 
* common-name:
** a (2e,5z)-alkan-2,5-dienoyl-coa
+
** o-ureido-l-homoserine
 +
* smiles:
 +
** c(cc(c(=o)[o-])[n+])onc(n)=o
 +
* inchi-key:
 +
** sfyvzosiaizwqu-vkhmyheasa-n
 +
* molecular-weight:
 +
** 177.16
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12519]]
+
* [[RXN-10]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12518]]
+
* [[RXN-9]]
* [[RXN-12519]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (2e,5z)-alkan-2,5-dienoyl-coa}}
+
{{#set: common-name=o-ureido-l-homoserine}}
 +
{{#set: inchi-key=inchikey=sfyvzosiaizwqu-vkhmyheasa-n}}
 +
{{#set: molecular-weight=177.16}}

Latest revision as of 11:12, 18 March 2021

Metabolite O-UREIDOHOMOSERINE

  • common-name:
    • o-ureido-l-homoserine
  • smiles:
    • c(cc(c(=o)[o-])[n+])onc(n)=o
  • inchi-key:
    • sfyvzosiaizwqu-vkhmyheasa-n
  • molecular-weight:
    • 177.16

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality